Difference between revisions of "CPD-10269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-carboxylates 2-Hydroxy-carboxylates] == * common name: ** a 2-hydroxy carboxylate * S...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-carboxylates 2-Hydroxy-carboxylates] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] ==
 +
* smiles:
 +
** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** a 2-hydroxy carboxylate
+
** palmitoleoyl-CoA
 +
* inchi key:
 +
** InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
 +
* molecular weight:
 +
** 999.899   
 
* Synonym(s):
 
* Synonym(s):
 +
** 16:1-delta9-CoA
 +
** 9z-hexadecenoyl-CoA
 +
** cis-9-hexadecenoyl-CoA
 +
** palmitoleoyl coenzyme A
 +
** (9Z)-hexadec-9-enoyl-CoA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17019]]
 +
* [[RXN-17008]]
 +
* [[RXN-17009]]
 +
* [[RXN-17788]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7919]]
+
* [[RXN-17787]]
 +
* [[RXN0-7248]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a 2-hydroxy carboxylate}}
+
* PUBCHEM:
{{#set: produced by=RXN-7919}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244393 25244393]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61540 61540]
 +
* METABOLIGHTS : MTBLC61540
 +
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: common name=palmitoleoyl-CoA}}
 +
{{#set: inchi key=InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J}}
 +
{{#set: molecular weight=999.899    }}
 +
{{#set: common name=16:1-delta9-CoA|9z-hexadecenoyl-CoA|cis-9-hexadecenoyl-CoA|palmitoleoyl coenzyme A|(9Z)-hexadec-9-enoyl-CoA}}
 +
{{#set: consumed by=RXN-17019|RXN-17008|RXN-17009|RXN-17788}}
 +
{{#set: produced by=RXN-17787|RXN0-7248}}

Latest revision as of 19:59, 21 March 2018

Metabolite CPD-10269

  • smiles:
    • CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • palmitoleoyl-CoA
  • inchi key:
    • InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
  • molecular weight:
    • 999.899
  • Synonym(s):
    • 16:1-delta9-CoA
    • 9z-hexadecenoyl-CoA
    • cis-9-hexadecenoyl-CoA
    • palmitoleoyl coenzyme A
    • (9Z)-hexadec-9-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.