Difference between revisions of "RFH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RFH RFH] == * direction: ** LEFT-TO-RIGHT * common name: ** raffinose fructohydrolase * Synonym(s):...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RFH RFH] ==
* smiles:
+
* direction:
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(5Z)-dodecenoyl-CoA
+
** raffinose fructohydrolase
* molecular weight:
+
** 957.775   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-12:1-Δ5-CoA
 
** 3-oxo-5-cis-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17799]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD-1099]][h] '''+''' 1.0 [[WATER]][h] '''=>''' 1.0 [[BETA-D-FRUCTOSE]][h] '''+''' 1.0 [[MELIBIOSE]][h]
* [[RXN-17798]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 raffinose[h] '''+''' 1.0 H2O[h] '''=>''' 1.0 β-D-fructofuranose[h] '''+''' 1.0 melibiose[h]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1580]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_1006]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
{{#set: common name=raffinose fructohydrolase}}
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_1580|Tiso_gene_1006}}
{{#set: molecular weight=957.775    }}
+
{{#set: in pathway=}}
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: consumed by=RXN-17799}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: produced by=RXN-17798}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:59, 21 March 2018

Reaction RFH

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • raffinose fructohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 raffinose[h] + 1.0 H2O[h] => 1.0 β-D-fructofuranose[h] + 1.0 melibiose[h]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links