Difference between revisions of "CPD-19153"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13588 == * left end position: ** 69 * transcription direction: ** NEGATIVE * right end position: ** 3337 * centisome position: ** 1.1125443...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_13588 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
* left end position:
+
* smiles:
** 69
+
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** NEGATIVE
+
** 3-oxo-(5Z)-dodecenoyl-CoA
* right end position:
+
* inchi key:
** 3337
+
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
* centisome position:
+
* molecular weight:
** 1.1125443    
+
** 957.775    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-12:1-Δ5-CoA
 +
** 3-oxo-5-cis-dodecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
* [[RXN-17799]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-17798]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
* [[PROTEIN-KINASE-RXN]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-11201]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=69}}
+
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=NEGATIVE}}
+
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
{{#set: right end position=3337}}
+
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
{{#set: centisome position=1.1125443   }}
+
{{#set: molecular weight=957.775   }}
{{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|PROTEIN-KINASE-RXN|RXN-11201}}
+
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17799}}
 +
{{#set: produced by=RXN-17798}}

Latest revision as of 20:59, 21 March 2018

Metabolite CPD-19153

  • smiles:
    • CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(5Z)-dodecenoyl-CoA
  • inchi key:
    • InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
  • molecular weight:
    • 957.775
  • Synonym(s):
    • 3-oxo-12:1-Δ5-CoA
    • 3-oxo-5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.