Difference between revisions of "RXN-16165"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == * smiles: ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HNOA...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16165 RXN-16165] == * direction: ** LEFT-TO-RIGHT * common name: ** methionyl-trna_synthetase *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16165 RXN-16165] ==
−
* smiles:
+
* direction:
−
** C(CCC(O)CC(C([O-])=O)=O)([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L
+
 
* common name:
 
* common name:
−
** (4S)-4-hydroxy-2-oxoheptanedioate
+
** methionyl-trna_synthetase
−
* molecular weight:
+
* ec number:
−
** 188.137   
+
** [http://enzyme.expasy.org/EC/6.1.1.10 EC-6.1.1.10]
 
* Synonym(s):
 
* Synonym(s):
−
** 4-hydroxy-2-ketoheptane-1,7-dioate
 
−
** 2-oxo-4-hydroxyhepta-1,7-dioate
 
−
** 4-hydroxy-2-oxo-heptanedioate
 
−
** 4-hydroxy-2-ketopimelate
 
−
** 2-keto-4-hydroxypimelate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[Initiation-tRNAmet]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[L-methionyl-tRNAfmet]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 L-methionine[c] '''+''' 1 initiator tRNAmet[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 an L-methionyl-[initiator tRNAmet][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_284]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_406]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91828275 91828275]
+
{{#set: common name=methionyl-trna_synthetase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-6.1.1.10}}
−
** [http://www.chemspider.com/Chemical-Structure.19951289.html 19951289]
+
{{#set: gene associated=Tiso_gene_284|Tiso_gene_406}}
−
* CHEBI:
+
{{#set: in pathway=TRNA-CHARGING-PWY}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87522 87522]
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05601 C05601]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(CCC(O)CC(C([O-])=O)=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L}}
+
−
{{#set: common name=(4S)-4-hydroxy-2-oxoheptanedioate}}
+
−
{{#set: molecular weight=188.137    }}
+
−
{{#set: common name=4-hydroxy-2-ketoheptane-1,7-dioate|2-oxo-4-hydroxyhepta-1,7-dioate|4-hydroxy-2-oxo-heptanedioate|4-hydroxy-2-ketopimelate|2-keto-4-hydroxypimelate}}
+
−
{{#set: consumed by=4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN}}
+

Latest revision as of 20:00, 21 March 2018

Reaction RXN-16165

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • methionyl-trna_synthetase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 L-methionine[c] + 1 initiator tRNAmet[c] => 1 AMP[c] + 1 diphosphate[c] + 1 an L-methionyl-[initiator tRNAmet][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16165&oldid=45154"