Difference between revisions of "RXN-14193"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14193 RXN-14193] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14193 RXN-14193] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[PROTON]][c] '''+''' 1.0 [[BUTYRYL-COA]][c] '''+''' 1.0 [[FAD]][c] '''<=>''' 1.0 [[FADH2]][c] '''+''' 1.0 [[CROTONYL-COA]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 H+[c] '''+''' 1.0 butanoyl-CoA[c] '''+''' 1.0 FAD[c] '''<=>''' 1.0 FADH2[c] '''+''' 1.0 crotonyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18566]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6475]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8272]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14511]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: gene associated=Tiso_gene_18566|Tiso_gene_6475|Tiso_gene_8272|Tiso_gene_14511}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:00, 21 March 2018
Contents
Reaction RXN-14193
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 PROTON[c] + 1.0 BUTYRYL-COA[c] + 1.0 FAD[c] <=> 1.0 FADH2[c] + 1.0 CROTONYL-COA[c]
- With common name(s):
- 1.0 H+[c] + 1.0 butanoyl-CoA[c] + 1.0 FAD[c] <=> 1.0 FADH2[c] + 1.0 crotonyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18566
- Source: orthology-esiliculosus
- Gene: Tiso_gene_6475
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8272
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14511
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus