Difference between revisions of "MG-PROTOPORPHYRIN-MONOMETHYL-ESTER"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta13-lacceroyl-ACPs cis-delta13-lacceroyl-ACPs] == * common name: ** a cis-delta13-C32:1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8)))) | ||
* common name: | * common name: | ||
| − | ** | + | ** magnesium-protoporphyrin IX 13-monomethyl ester |
| + | * molecular weight: | ||
| + | ** 597.975 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** Mg-protoporphyrin monomethyl ester | ||
| + | ** magnesium protoporphyrin monomethyl ester | ||
| + | ** MgPMME | ||
| + | ** magnesium-protoporphyrin IX 13-methyl ester | ||
| + | ** MgP monomethyl ester | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5282]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954] |
| − | {{#set: produced by= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536] | ||
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}} | ||
| + | {{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}} | ||
| + | {{#set: molecular weight=597.975 }} | ||
| + | {{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}} | ||
| + | {{#set: consumed by=RXN-5282}} | ||
| + | {{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}} | ||
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER
- smiles:
- C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
- common name:
- magnesium-protoporphyrin IX 13-monomethyl ester
- molecular weight:
- 597.975
- Synonym(s):
- Mg-protoporphyrin monomethyl ester
- magnesium protoporphyrin monomethyl ester
- MgPMME
- magnesium-protoporphyrin IX 13-methyl ester
- MgP monomethyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.
