Difference between revisions of "RXN-17881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17881 RXN-17881] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17881 RXN-17881] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
+
** LEFT-TO-RIGHT
−
* common name:
+
−
** magnesium-protoporphyrin IX 13-monomethyl ester
+
−
* molecular weight:
+
−
** 597.975   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Mg-protoporphyrin monomethyl ester
 
−
** magnesium protoporphyrin monomethyl ester
 
−
** MgPMME
 
−
** magnesium-protoporphyrin IX 13-methyl ester
 
−
** MgP monomethyl ester
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5282]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[N-terminal-L-cysteine]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[N-terminal-L-alanine-sulfenate]][c]
−
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 hydrogen peroxide[c] '''+''' 1 an N-terminal L-cysteinyl-[protein][c] '''=>''' 1 H2O[c] '''+''' 1 an N-terminal 3-sulfeno-L-alanyl-[protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
 +
** '''8''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954]
+
{{#set: in pathway=PWY-7799}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}}
+
−
{{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=597.975    }}
+
−
{{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}}
+
−
{{#set: consumed by=RXN-5282}}
+
−
{{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+

Latest revision as of 20:00, 21 March 2018

Reaction RXN-17881

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7799, Arg/N-end rule pathway (eukaryotic): PWY-7799
    • 8 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17881&oldid=45183"