Difference between revisions of "RXN-18201"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18201 RXN-18201] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18201 RXN-18201] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[PROTON]][c] '''+''' 1 [[CPD-19487]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPDQT-41]][c] | |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 H+[c] '''+''' 1 3-isopropyl-10-(methylthio)-2-oxodecanoate[c] '''=>''' 1 CO2[c] '''+''' 1 10-(methylthio)-2-oxodecanoate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450] | ||
+ | ** '''10''' reactions found over '''30''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=PWYQT-4450}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:00, 21 March 2018
Contents
Reaction RXN-18201
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 CPD-19487[c] => 1 CARBON-DIOXIDE[c] + 1 CPDQT-41[c]
- With common name(s):
- 1 H+[c] + 1 3-isopropyl-10-(methylthio)-2-oxodecanoate[c] => 1 CO2[c] + 1 10-(methylthio)-2-oxodecanoate[c]
Genes associated with this reaction
Pathways
- PWYQT-4450, aliphatic glucosinolate biosynthesis, side chain elongation cycle: PWYQT-4450
- 10 reactions found over 30 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation