Difference between revisions of "DGTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] == * direction: ** LEFT-TO-RIGHT * common name: ** atp-sulfurylase * ec number...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
 
* common name:
 
* common name:
−
** atp-sulfurylase
+
** dGTP
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.7.4 EC-2.7.7.4]
+
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
 +
* molecular weight:
 +
** 503.152   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2'-deoxyguanosine-5'-triphosphate
 +
** deoxy-GTP
 +
** deoxyguanosine-triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[DGTCY]]
−
** 1 [[SELENATE]][c] '''+''' 1 [[ATP]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-13713]][c]
+
* [[DGTUP]]
−
* With common name(s):
+
* [[RXN0-385]]
−
** 1 selenate[c] '''+''' 1 ATP[c] '''+''' 2 H+[c] '''=>''' 1 diphosphate[c] '''+''' 1 adenosine 5'-phosphoselenate[c]
+
* [[RME255]]
−
 
+
* [[RXN-11410]]
−
== Genes associated with this reaction  ==
+
* [[RXN-14208]]
−
Genes have been associated with this reaction based on different elements listed below.
+
* [[RXN-14217]]
−
* [[Tiso_gene_10254]]
+
* [[DGTD]]
−
** IN-SILICO_ANNOTATION
+
== Reaction(s) known to produce the compound ==
−
***AUTOMATED-NAME-MATCH
+
* [[ATDGD]]
−
** [[pantograph]]-[[athaliana]]
+
* [[DGDPKIN-RXN]]
−
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
−
== Pathways  ==
+
* [[RXN-14207]]
−
* [[PWY-6932]], selenate reduction: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6932 PWY-6932]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 2564-35-4
−
{{#set: common name=atp-sulfurylase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.7.7.4}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112]
−
{{#set: gene associated=Tiso_gene_10254}}
+
* HMDB : HMDB01440
−
{{#set: in pathway=PWY-6932}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
−
{{#set: reconstruction source=esiliculosus|athaliana}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429]
−
{{#set: reconstruction category=annotation}}
+
* BIGG : dgtp
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=dGTP}}
 +
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}}
 +
{{#set: molecular weight=503.152    }}
 +
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}}
 +
{{#set: consumed by=DGTCY|DGTUP|RXN0-385|RME255|RXN-11410|RXN-14208|RXN-14217|DGTD}}
 +
{{#set: produced by=ATDGD|DGDPKIN-RXN}}
 +
{{#set: reversible reaction associated=RXN-14207}}

Latest revision as of 20:00, 21 March 2018

Metabolite DGTP

  • smiles:
    • C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • common name:
    • dGTP
  • inchi key:
    • InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
  • molecular weight:
    • 503.152
  • Synonym(s):
    • 2'-deoxyguanosine-5'-triphosphate
    • deoxy-GTP
    • deoxyguanosine-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 2564-35-4
  • PUBCHEM:
  • HMDB : HMDB01440
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : dgtp
"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DGTP&oldid=45216"