Difference between revisions of "Tiso gene 17967"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] == * smiles: ** CC2(=C(C)N(CC(O)C(O)C(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17967 == * right end position: ** 2220 * transcription direction: ** POSITIVE * left end position: ** 159 * centisome position: ** 4.753363...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] ==
+
== Gene Tiso_gene_17967 ==
−
* smiles:
+
* right end position:
−
** CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))
+
** 2220
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 6,7-dimethyl-8-(1-D-ribityl)lumazine
+
** 159
−
* molecular weight:
+
* centisome position:
−
** 325.3    
+
** 4.753363    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RIBOFLAVIN-SYN-RXN]]
+
* Reaction: [[ACOA120or]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ACOA140or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACOA160or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACOA40or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACOA80or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[PPCOAOm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-11734]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13451]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13615]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14131]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14229]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14262]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14278]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16540]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16557]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7094]]
 +
* [[PWY-7654]]
 +
* [[PWY-7656]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=2220}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04332 C04332]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=159}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58201 58201]
+
{{#set: centisome position=4.753363    }}
−
* BIGG : dmlz
+
{{#set: reaction associated=ACOA120or|ACOA140or|ACOA160or|ACOA40or|ACOA80or|LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN|PPCOAOm|RXN-11734|RXN-13451|RXN-13615|RXN-14131|RXN-14229|RXN-14262|RXN-14278|RXN-16540|RXN-16557}}
−
* PUBCHEM:
+
{{#set: pathway associated=PWY-7094|PWY-7654|PWY-7656}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931117 46931117]
+
−
* HMDB : HMDB03826
+
−
{{#set: smiles=CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))}}
+
−
{{#set: inchi key=InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M}}
+
−
{{#set: common name=6,7-dimethyl-8-(1-D-ribityl)lumazine}}
+
−
{{#set: molecular weight=325.3    }}
+
−
{{#set: consumed by=RIBOFLAVIN-SYN-RXN}}
+

Latest revision as of 20:01, 21 March 2018

Gene Tiso_gene_17967

  • right end position:
    • 2220
  • transcription direction:
    • POSITIVE
  • left end position:
    • 159
  • centisome position:
    • 4.753363
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17967&oldid=45245"