Difference between revisions of "DIMETHYL-D-RIBITYL-LUMAZINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2171 CPD0-2171] == * smiles: ** CCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] == * smiles: ** CC2(=C(C)N(CC(O)C(O)C(...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** 6,7-dimethyl-8-(1-D-ribityl)lumazine |
+ | * inchi key: | ||
+ | ** InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 325.3 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RIBOFLAVIN-SYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04332 C04332] |
+ | * HMDB : HMDB03826 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58201 58201] |
− | * BIGG : | + | * BIGG : dmlz |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931117 46931117] |
− | + | {{#set: smiles=CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))}} | |
− | {{#set: smiles= | + | {{#set: common name=6,7-dimethyl-8-(1-D-ribityl)lumazine}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M}} |
− | {{#set: | + | {{#set: molecular weight=325.3 }} |
− | {{#set: molecular weight= | + | {{#set: consumed by=RIBOFLAVIN-SYN-RXN}} |
− | {{#set: consumed by= | + |
Latest revision as of 21:01, 21 March 2018
Contents
Metabolite DIMETHYL-D-RIBITYL-LUMAZINE
- smiles:
- CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))
- common name:
- 6,7-dimethyl-8-(1-D-ribityl)lumazine
- inchi key:
- InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M
- molecular weight:
- 325.3
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))" cannot be used as a page name in this wiki.