Difference between revisions of "Tiso gene 4164"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_4164 == * right end position: ** 7436 * transcription direction: ** NEGATIVE * left end position: ** 6 * centisome position: ** 3.927215600...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4164 == |
− | * | + | * right end position: |
− | ** | + | ** 7436 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 6 |
− | * | + | * centisome position: |
− | ** | + | ** 3.927215600e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.1.3.16-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
+ | * Reaction: [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7436}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=6}} | |
− | + | {{#set: centisome position=3.927215600e-2}} | |
− | + | {{#set: reaction associated=3.1.3.16-RXN|PROTEIN-TYROSINE-PHOSPHATASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:02, 21 March 2018
Gene Tiso_gene_4164
- right end position:
- 7436
- transcription direction:
- NEGATIVE
- left end position:
- 6
- centisome position:
- 3.927215600e-2
- Synonym(s):
Reactions associated
- Reaction: 3.1.3.16-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: PROTEIN-TYROSINE-PHOSPHATASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation