Difference between revisions of "HOMO-CIS-ACONITATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12021 == * left end position: ** 82 * transcription direction: ** NEGATIVE * right end position: ** 2443 * centisome position: ** 1.1136764...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * c...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** cis-homoaconitate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 185.113 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-carboxyhex-2-enedioate | ||
+ | ** (Z)-but-1-ene-1,2,4-tricarboxylate | ||
+ | ** homo-cis-aconitate | ||
+ | ** (Z)-1,2,4-but-1-enetricarboxylic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[HOMOACONITATE-HYDRATASE-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158450 21158450] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20117984.html 20117984] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58174 58174] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04002 C04002] | ||
+ | {{#set: smiles=C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]}} | ||
+ | {{#set: common name=cis-homoaconitate}} | ||
+ | {{#set: inchi key=InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K}} | ||
+ | {{#set: molecular weight=185.113 }} | ||
+ | {{#set: common name=3-carboxyhex-2-enedioate|(Z)-but-1-ene-1,2,4-tricarboxylate|homo-cis-aconitate|(Z)-1,2,4-but-1-enetricarboxylic acid}} | ||
+ | {{#set: reversible reaction associated=HOMOACONITATE-HYDRATASE-RXN}} |
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite HOMO-CIS-ACONITATE
- smiles:
- C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]
- common name:
- cis-homoaconitate
- inchi key:
- InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K
- molecular weight:
- 185.113
- Synonym(s):
- 3-carboxyhex-2-enedioate
- (Z)-but-1-ene-1,2,4-tricarboxylate
- homo-cis-aconitate
- (Z)-1,2,4-but-1-enetricarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-" cannot be used as a page name in this wiki.