Difference between revisions of "Tiso gene 16011"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...")
 
(Created page with "Category:Gene == Gene Tiso_gene_16011 == * right end position: ** 4176 * transcription direction: ** POSITIVE * left end position: ** 272 * centisome position: ** 5.850720...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] ==
+
== Gene Tiso_gene_16011 ==
−
* smiles:
+
* right end position:
−
** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
+
** 4176
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
+
** 272
−
* molecular weight:
+
* centisome position:
−
** 264.169    
+
** 5.8507204    
 
* Synonym(s):
 
* Synonym(s):
−
** cThz-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12610]]
+
* Reaction: [[AIRCARBOXY-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-742]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-6123]]
 +
* [[PWY-6124]]
 +
* [[PWY-7234]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4176}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=272}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890]
+
{{#set: centisome position=5.8507204   }}
−
{{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}}
+
{{#set: reaction associated=AIRCARBOXY-RXN|RXN0-742}}
−
{{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}}
+
{{#set: pathway associated=PWY-6123|PWY-6124|PWY-7234}}
−
{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
+
−
{{#set: molecular weight=264.169   }}
+
−
{{#set: common name=cThz-P}}
+
−
{{#set: consumed by=RXN-12610}}
+

Latest revision as of 20:02, 21 March 2018

Gene Tiso_gene_16011

  • right end position:
    • 4176
  • transcription direction:
    • POSITIVE
  • left end position:
    • 272
  • centisome position:
    • 5.8507204
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16011&oldid=45423"