Difference between revisions of "RXN-7967"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == * smiles: ** C([N+])CC[N+]=CCCC[N+] * inchi key: ** InChIKey=YAVLYBVKPX...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7967 RXN-7967] == * direction: ** LEFT-TO-RIGHT * common name: ** pentafunctional_protein * ec...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7967 RXN-7967] ==
* smiles:
+
* direction:
** C([N+])CC[N+]=CCCC[N+]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
+
 
* common name:
 
* common name:
** dehydrospermidine
+
** pentafunctional_protein
* molecular weight:
+
* ec number:
** 146.255   
+
** [http://enzyme.expasy.org/EC/1.1.1.282 EC-1.1.1.282]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13415]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[QUINATE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[DEHYDROQUINATE]][c] '''+''' 1 [[PROTON]][c]
* [[RXN-13414]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 L-quinate[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 NAD(P)H[c] '''+''' 1 3-dehydroquinate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5753]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5752]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266746 45266746]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06846 R06846]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732]
+
{{#set: common name=pentafunctional_protein}}
* METABOLIGHTS : MTBLC58732
+
{{#set: ec number=EC-1.1.1.282}}
{{#set: smiles=C([N+])CC[N+]=CCCC[N+]}}
+
{{#set: gene associated=Tiso_gene_5753|Tiso_gene_5752}}
{{#set: inchi key=InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q}}
+
{{#set: in pathway=}}
{{#set: common name=dehydrospermidine}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: molecular weight=146.255    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
{{#set: consumed by=RXN-13415}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: produced by=RXN-13414}}
+

Latest revision as of 21:02, 21 March 2018

Reaction RXN-7967

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • pentafunctional_protein
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links