Difference between revisions of "DTDP-RHAMNOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5939 == * left end position: ** 9686 * transcription direction: ** NEGATIVE * right end position: ** 12287 * centisome position: ** 76.0342...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5939 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] ==
* left end position:
+
* smiles:
** 9686
+
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))
* transcription direction:
+
* common name:
** NEGATIVE
+
** dTDP-β-L-rhamnose
* right end position:
+
* inchi key:
** 12287
+
** InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L
* centisome position:
+
* molecular weight:
** 76.034225    
+
** 546.317    
 
* Synonym(s):
 
* Synonym(s):
 +
** dTDP-6-deoxy-β-L-mannose
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.3.1.41-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[DTDPDEHYRHAMREDUCT-RXN]]
***ec-number
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
***ec-number
+
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[3-OXOACYL-ACP-SYNTH-RXN]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-10059]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-10654]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-10658]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-11474]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-11479]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16615]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16621]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16625]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16629]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9516]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9523]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9527]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9531]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9535]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9539]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9632]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9648]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9650]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9651]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9652]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9653]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9654]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN0-2141]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-368]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-445]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-460]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-499]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN3O-1803]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-6113]]
+
* [[FASYN-ELONG-PWY]]
+
* [[PWY-6519]]
+
* [[PWY-7388]]
+
* [[PWY-5994]]
+
* [[PWY-5971]]
+
* [[PWY-6282]]
+
* [[PWY-5965]]
+
* [[PWY-5989]]
+
* [[PWY-5966]]
+
* [[PWYG-321]]
+
* [[FASYN-INITIAL-PWY]]
+
* [[PWY-7663]]
+
* [[PWY-7664]]
+
* [[PWY3O-355]]
+
* [[PWY0-862]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=9686}}
+
* CAS : 572-96-3
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=12287}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245982 25245982]
{{#set: centisome position=76.034225   }}
+
* HMDB : HMDB06354
{{#set: reaction associated=2.3.1.41-RXN|3-OXOACYL-ACP-SYNTH-BASE-RXN|3-OXOACYL-ACP-SYNTH-RXN|RXN-10059|RXN-10654|RXN-10658|RXN-11474|RXN-11479|RXN-16615|RXN-16621|RXN-16625|RXN-16629|RXN-9516|RXN-9523|RXN-9527|RXN-9531|RXN-9535|RXN-9539|RXN-9632|RXN-9648|RXN-9650|RXN-9651|RXN-9652|RXN-9653|RXN-9654|RXN0-2141|RXN1G-368|RXN1G-445|RXN1G-460|RXN1G-499|RXN3O-1803}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-6113|FASYN-ELONG-PWY|PWY-6519|PWY-7388|PWY-5994|PWY-5971|PWY-6282|PWY-5965|PWY-5989|PWY-5966|PWYG-321|FASYN-INITIAL-PWY|PWY-7663|PWY-7664|PWY3O-355|PWY0-862}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03319 C03319]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57510 57510]
 +
* BIGG : dtdprmn
 +
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))}}
 +
{{#set: common name=dTDP-β-L-rhamnose}}
 +
{{#set: inchi key=InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L}}
 +
{{#set: molecular weight=546.317   }}
 +
{{#set: common name=dTDP-6-deoxy-β-L-mannose}}
 +
{{#set: produced by=DTDPDEHYRHAMREDUCT-RXN}}

Latest revision as of 20:02, 21 March 2018

Metabolite DTDP-RHAMNOSE

  • smiles:
    • CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))
  • common name:
    • dTDP-β-L-rhamnose
  • inchi key:
    • InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L
  • molecular weight:
    • 546.317
  • Synonym(s):
    • dTDP-6-deoxy-β-L-mannose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 572-96-3
  • PUBCHEM:
  • HMDB : HMDB06354
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : dtdprmn
"CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))" cannot be used as a page name in this wiki.