Difference between revisions of "PWY-5064"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J
+
 
* common name:
 
* common name:
−
** 4-coumaroyl-CoA
+
** chlorophyll a biosynthesis II
−
* molecular weight:
+
−
** 909.648   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaroyl-CoA
 
−
** 4-hydroxycinnamoyl-CoA
 
−
** 4-coumaryl-CoA
 
−
** p-coumaryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-11244]]
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
* [[RXN-1101]]
+
* [[RXN-5286]]
−
* [[RXN-3142]]
+
** 1 associated gene(s):
−
== Reaction(s) known to produce the compound ==
+
*** [[Tiso_gene_13868]]
−
* [[4-COUMARATE--COA-LIGASE-RXN]]
+
** 2 reconstruction source(s) associated:
−
== Reaction(s) of unknown directionality ==
+
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-7663]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_19542]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-7664]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2613]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-7665]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2613]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-7666]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2613]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266584 45266584]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5064 PWY-5064]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15499 15499]
+
{{#set: common name=chlorophyll a biosynthesis II}}
−
* LIGAND-CPD:
+
{{#set: reaction found=5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00223 C00223]
+
{{#set: total reaction=5}}
−
* HMDB : HMDB60153
+
{{#set: completion rate=100.0}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J}}
+
−
{{#set: common name=4-coumaroyl-CoA}}
+
−
{{#set: molecular weight=909.648    }}
+
−
{{#set: common name=p-coumaroyl-CoA|4-hydroxycinnamoyl-CoA|4-coumaryl-CoA|p-coumaryl-CoA}}
+
−
{{#set: consumed by=RXN-11244|RXN-1101|RXN-3142}}
+
−
{{#set: produced by=4-COUMARATE--COA-LIGASE-RXN}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-5064

  • taxonomic range:
  • common name:
    • chlorophyll a biosynthesis II
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5064&oldid=39880"