Difference between revisions of "OXALO-SUCCINATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1588 == * left end position: ** 10009 * transcription direction: ** POSITIVE * right end position: ** 10692 * centisome position: ** 43.438...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * commo...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O |
− | * | + | * common name: |
− | ** | + | ** oxalosuccinate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 187.085 |
* Synonym(s): | * Synonym(s): | ||
+ | ** oxalo-succ | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-8642]] | |
− | * [[ | + | * [[RXN-9951]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05379 C05379] |
− | {{#set: | + | * HMDB : HMDB03974 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58931 58931] |
− | {{#set: | + | * METABOLIGHTS : MTBLC58931 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244267 25244267] | ||
+ | {{#set: smiles=C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O}} | ||
+ | {{#set: common name=oxalosuccinate}} | ||
+ | {{#set: inchi key=InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K}} | ||
+ | {{#set: molecular weight=187.085 }} | ||
+ | {{#set: common name=oxalo-succ}} | ||
+ | {{#set: reversible reaction associated=RXN-8642|RXN-9951}} |
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite OXALO-SUCCINATE
- smiles:
- C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O
- common name:
- oxalosuccinate
- inchi key:
- InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K
- molecular weight:
- 187.085
- Synonym(s):
- oxalo-succ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O" cannot be used as a page name in this wiki.