Difference between revisions of "A-3-OXO-ACID"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-5Z-tetradeca-2-5-dienoyl-ACPs 2E-5Z-tetradeca-2-5-dienoyl-ACPs] == * common name: ** a (2E,5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == * smiles: ** C([R])C(=O)CC(=O)[O-] * common name: ** a 3-oxo acid...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == |
+ | * smiles: | ||
+ | ** C([R])C(=O)CC(=O)[O-] | ||
* common name: | * common name: | ||
− | ** a | + | ** a 3-oxo acid |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxy acid | ||
+ | ** 3-oxygen acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[3-OXOACID-COA-TRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name=a | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01656 C01656] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47881 47881] | ||
+ | {{#set: smiles=C([R])C(=O)CC(=O)[O-]}} | ||
+ | {{#set: common name=a 3-oxo acid}} | ||
+ | {{#set: common name=3-oxy acid|3-oxygen acid}} | ||
+ | {{#set: reversible reaction associated=3-OXOACID-COA-TRANSFERASE-RXN}} |
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite A-3-OXO-ACID
- smiles:
- C([R])C(=O)CC(=O)[O-]
- common name:
- a 3-oxo acid
- Synonym(s):
- 3-oxy acid
- 3-oxygen acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([R])C(=O)CC(=O)[O-" cannot be used as a page name in this wiki.