Difference between revisions of "A-3-OXO-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-5Z-tetradeca-2-5-dienoyl-ACPs 2E-5Z-tetradeca-2-5-dienoyl-ACPs] == * common name: ** a (2E,5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == * smiles: ** C([R])C(=O)CC(=O)[O-] * common name: ** a 3-oxo acid...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-5Z-tetradeca-2-5-dienoyl-ACPs 2E-5Z-tetradeca-2-5-dienoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] ==
 +
* smiles:
 +
** C([R])C(=O)CC(=O)[O-]
 
* common name:
 
* common name:
** a (2E,5Z)-tetradeca-2,5-dienoyl-[acp]
+
** a 3-oxo acid
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxy acid
 +
** 3-oxygen acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16619]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[3-OXOACID-COA-TRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a (2E,5Z)-tetradeca-2,5-dienoyl-[acp]}}
+
* LIGAND-CPD:
{{#set: produced by=RXN-16619}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01656 C01656]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47881 47881]
 +
{{#set: smiles=C([R])C(=O)CC(=O)[O-]}}
 +
{{#set: common name=a 3-oxo acid}}
 +
{{#set: common name=3-oxy acid|3-oxygen acid}}
 +
{{#set: reversible reaction associated=3-OXOACID-COA-TRANSFERASE-RXN}}

Latest revision as of 20:03, 21 March 2018

Metabolite A-3-OXO-ACID

  • smiles:
    • C([R])C(=O)CC(=O)[O-]
  • common name:
    • a 3-oxo acid
  • Synonym(s):
    • 3-oxy acid
    • 3-oxygen acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([R])C(=O)CC(=O)[O-" cannot be used as a page name in this wiki.