Difference between revisions of "CPD1F-132"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HMNOS HMNOS] == * direction: ** REVERSIBLE * common name: ** (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HMNOS HMNOS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
 
* common name:
 
* common name:
−
** (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA:NAD+ oxidoreductase
+
** ent-kaur-16-en-19-oate
 +
* inchi key:
 +
** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
 +
* molecular weight:
 +
** 301.448   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-kaurenoate
 +
** ent-kaurenoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.14.13.79-RXN]]
−
** 1.0 [[2-METHYL-3-HYDROXY-BUTYRYL-COA]][m] '''+''' 1.0 [[NAD]][m] '''<=>''' 1.0 [[PROTON]][m] '''+''' 1.0 [[2-METHYL-ACETO-ACETYL-COA]][m] '''+''' 1.0 [[NADH]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7580]]
−
** 1.0 (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA[m] '''+''' 1.0 NAD+[m] '''<=>''' 1.0 H+[m] '''+''' 1.0 2-methylacetoacetyl-CoA[m] '''+''' 1.0 NADH[m]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5857]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIPID_MAPS : LMPR0104130004
−
{{#set: common name=(2S,3S)-3-hydroxy-2-methylbutanoyl-CoA:NAD+ oxidoreductase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_5857}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785]
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874]
 +
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}}
 +
{{#set: common name=ent-kaur-16-en-19-oate}}
 +
{{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}}
 +
{{#set: molecular weight=301.448    }}
 +
{{#set: common name=ent-kaurenoate|ent-kaurenoic acid}}
 +
{{#set: consumed by=1.14.13.79-RXN}}
 +
{{#set: produced by=RXN-7580}}

Latest revision as of 20:03, 21 March 2018

Metabolite CPD1F-132

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
  • common name:
    • ent-kaur-16-en-19-oate
  • inchi key:
    • InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
  • molecular weight:
    • 301.448
  • Synonym(s):
    • ent-kaurenoate
    • ent-kaurenoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-132&oldid=45610"