Difference between revisions of "Tiso gene 6190"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_6190 == * right end position: ** 6596 * transcription direction: ** POSITIVE * left end position: ** 5511 * centisome position: ** 44.24729...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6190 == |
− | * | + | * right end position: |
− | ** | + | ** 6596 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5511 |
− | * | + | * centisome position: |
− | ** | + | ** 44.24729 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[BTUR2-RXN]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | * Reaction: [[COBALADENOSYLTRANS-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[RXN- | + | * Reaction: [[R344-RXN]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | == Pathways associated == | ||
+ | * [[COBALSYN-PWY]] | ||
+ | * [[PWY-6269]] | ||
+ | * [[PWY-6268]] | ||
+ | * [[PWY-5509]] | ||
+ | * [[PWY-5508]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6596}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5511}} | |
− | + | {{#set: centisome position=44.24729 }} | |
− | + | {{#set: reaction associated=BTUR2-RXN|COBALADENOSYLTRANS-RXN|R344-RXN}} | |
− | + | {{#set: pathway associated=COBALSYN-PWY|PWY-6269|PWY-6268|PWY-5509|PWY-5508}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:04, 21 March 2018
Gene Tiso_gene_6190
- right end position:
- 6596
- transcription direction:
- POSITIVE
- left end position:
- 5511
- centisome position:
- 44.24729
- Synonym(s):
Reactions associated
- Reaction: BTUR2-RXN
- Source: orthology-esiliculosus
- Reaction: COBALADENOSYLTRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: R344-RXN
- Source: orthology-esiliculosus