Difference between revisions of "CPD-15663"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16842 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** pantograph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] == * smiles: ** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] == |
+ | * smiles: | ||
+ | ** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * common name: | ||
+ | ** 2-trans-nonenoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J | ||
+ | * molecular weight: | ||
+ | ** 901.711 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2E-nonenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-14793]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193739 72193739] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76292 76292] | ||
+ | {{#set: smiles=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=2-trans-nonenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J}} | ||
+ | {{#set: molecular weight=901.711 }} | ||
+ | {{#set: common name=2E-nonenoyl-CoA}} | ||
+ | {{#set: produced by=RXN-14793}} |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-15663
- smiles:
- CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 2-trans-nonenoyl-CoA
- inchi key:
- InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J
- molecular weight:
- 901.711
- Synonym(s):
- 2E-nonenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.