Difference between revisions of "RXN-7974"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7974 RXN-7974] == * direction: ** LEFT-TO-RIGHT * common name: ** 9-cis-epoxycarotenoid_dioxyge...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7974 RXN-7974] ==
* smiles:
+
* direction:
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J
+
 
* common name:
 
* common name:
** 2-trans, 4-trans-undecadienoyl-CoA
+
** 9-cis-epoxycarotenoid_dioxygenase
* molecular weight:
+
** 9-cis-epoxycarotenoid_neoxanthin_cleavage_enzyme-like_protein
** 927.749   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.13.11.51 EC-1.13.11.51]
 
* Synonym(s):
 
* Synonym(s):
** 2E, 4E-undecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14789]]
+
** 1 [[CPD-7196]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-7280]][c] '''+''' 1 [[CPD-7279]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 9-cis-violaxanthin[c] '''+''' 1 oxygen[c] '''=>''' 1 (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al[c] '''+''' 1 2-cis,4-trans-xanthoxin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4653]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7740]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658303 90658303]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16541 16541]
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* LIGAND-RXN:
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06953 R06953]
{{#set: common name=2-trans, 4-trans-undecadienoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: molecular weight=927.749    }}
+
{{#set: common name=9-cis-epoxycarotenoid_dioxygenase}}
{{#set: common name=2E, 4E-undecadienoyl-CoA}}
+
{{#set: common name=9-cis-epoxycarotenoid_neoxanthin_cleavage_enzyme-like_protein}}
{{#set: produced by=RXN-14789}}
+
{{#set: ec number=EC-1.13.11.51}}
 +
{{#set: gene associated=Tiso_gene_4653|Tiso_gene_7740}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 21:04, 21 March 2018

Reaction RXN-7974

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 9-cis-epoxycarotenoid_dioxygenase
    • 9-cis-epoxycarotenoid_neoxanthin_cleavage_enzyme-like_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 9-cis-violaxanthin[c] + 1 oxygen[c] => 1 (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al[c] + 1 2-cis,4-trans-xanthoxin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links