Difference between revisions of "CHOLINE-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-KINASE-RXN CHOLINE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** choline_e...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-KINASE-RXN CHOLINE-KINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** choline_ethanolamine_kinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.32 EC-2.7.1.32] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | + | * With identifiers: | |
− | * [[ | + | ** 1 [[CHOLINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[PHOSPHORYL-CHOLINE]][c] '''+''' 1 [[ADP]][c] |
− | + | * With common name(s): | |
− | * [[ | + | ** 1 choline[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 phosphocholine[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_16805]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782] |
− | + | ** '''7''' reactions found over '''16''' reactions in the full pathway | |
+ | * [[PWY3O-450]], phosphatidylcholine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-450 PWY3O-450] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-7818]], type IV lipoteichoic acid biosynthesis (S. pneumoniae): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7818 PWY-7818] | ||
+ | ** '''1''' reactions found over '''19''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12837 12837] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01021 R01021] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P20485 P20485] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q01134 Q01134] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q42809 Q42809] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q42810 Q42810] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q42811 Q42811] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=choline_ethanolamine_kinase}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.1.32}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_16805}} |
− | {{#set: | + | {{#set: in pathway=PWY-7782|PWY3O-450|PWY-7818}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:04, 21 March 2018
Contents
Reaction CHOLINE-KINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- choline_ethanolamine_kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CHOLINE[c] + 1 ATP[c] => 1 PROTON[c] + 1 PHOSPHORYL-CHOLINE[c] + 1 ADP[c]
- With common name(s):
- 1 choline[c] + 1 ATP[c] => 1 H+[c] + 1 phosphocholine[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16805
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-7782, plasmalogen biosynthesis: PWY-7782
- 7 reactions found over 16 reactions in the full pathway
- PWY3O-450, phosphatidylcholine biosynthesis I: PWY3O-450
- 1 reactions found over 3 reactions in the full pathway
- PWY-7818, type IV lipoteichoic acid biosynthesis (S. pneumoniae): PWY-7818
- 1 reactions found over 19 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links