Difference between revisions of "Tiso gene 5911"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * inchi key: ** InChIKey=ACRWYXSKEHUQ...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5911 == * right end position: ** 6643 * transcription direction: ** NEGATIVE * left end position: ** 3327 * centisome position: ** 26.03897...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] ==
+
== Gene Tiso_gene_5911 ==
−
* smiles:
+
* right end position:
−
** C(#N)CCC1(C=CC=CC=1)
+
** 6643
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 3-phenylpropionitrile
+
** 3327
−
* molecular weight:
+
* centisome position:
−
** 131.177    
+
** 26.038977    
 
* Synonym(s):
 
* Synonym(s):
−
** benzenepropanenitrile
 
−
** 2-phenylethyl cyanide
 
−
** 3-phenylpropanonitril
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-18229]]
+
* Reaction: [[5-NUCLEOTID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[AMP-DEPHOSPHORYLATION-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[NARP]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[NRPH]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-14025]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14026]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14227]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-5841]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7607]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7609]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[XMPXAN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5381]]
 +
* [[PWY-6607]]
 +
* [[PWY-7185]]
 +
* [[PWY-7821]]
 +
* [[SALVADEHYPOX-PWY]]
 +
* [[PWY-6596]]
 +
* [[NAD-BIOSYNTHESIS-II]]
 +
* [[PWY-6606]]
 +
* [[PWY-6608]]
 +
* [[PWY-5695]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6643}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=3327}}
−
** [http://www.chemspider.com/Chemical-Structure.12061.html 12061]
+
{{#set: centisome position=26.038977   }}
−
* CHEBI:
+
{{#set: reaction associated=5-NUCLEOTID-RXN|AMP-DEPHOSPHORYLATION-RXN|NARP|NRPH|RXN-14025|RXN-14026|RXN-14227|RXN-5841|RXN-7607|RXN-7609|XMPXAN-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426]
+
{{#set: pathway associated=PWY-5381|PWY-6607|PWY-7185|PWY-7821|SALVADEHYPOX-PWY|PWY-6596|NAD-BIOSYNTHESIS-II|PWY-6606|PWY-6608|PWY-5695}}
−
* HMDB : HMDB34236
+
−
{{#set: smiles=C(#N)CCC1(C=CC=CC=1)}}
+
−
{{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}}
+
−
{{#set: common name=3-phenylpropionitrile}}
+
−
{{#set: molecular weight=131.177   }}
+
−
{{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}}
+
−
{{#set: consumed by=RXN-18229}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_5911

  • right end position:
    • 6643
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3327
  • centisome position:
    • 26.038977
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5911&oldid=45707"