Difference between revisions of "CPD-12015"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16237 == * left end position: ** 2776 * transcription direction: ** NEGATIVE * right end position: ** 4391 * centisome position: ** 61.785...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * com...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) |
| − | * | + | * common name: |
| − | ** | + | ** 6-sulfatoxymelatonin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 327.331 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 6-sulphatoxymelatonin | ||
| + | ** 6-hydroxymelatoninsulfate | ||
| + | ** 6-hydroxymelatonin sulfate ester | ||
| + | ** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)- | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-11058]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=38988602 38988602] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.58606.html 58606] |
| − | {{#set: | + | * HMDB : HMDB41815 |
| − | {{#set: | + | {{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}} |
| + | {{#set: common name=6-sulfatoxymelatonin}} | ||
| + | {{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=327.331 }} | ||
| + | {{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}} | ||
| + | {{#set: produced by=RXN-11058}} | ||
Latest revision as of 21:05, 21 March 2018
Contents
Metabolite CPD-12015
- smiles:
- CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
- common name:
- 6-sulfatoxymelatonin
- inchi key:
- InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
- molecular weight:
- 327.331
- Synonym(s):
- 6-sulphatoxymelatonin
- 6-hydroxymelatoninsulfate
- 6-hydroxymelatonin sulfate ester
- acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))" cannot be used as a page name in this wiki.
