Difference between revisions of "Tiso gene 6799"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_6799 == * right end position: ** 11763 * transcription direction: ** NEGATIVE * left end position: ** 8738 * centisome position: ** 73.9443...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] ==
+
== Gene Tiso_gene_6799 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 11763
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 5-trans-3-oxo-dodecenoyl-CoA
+
** 8738
−
* molecular weight:
+
* centisome position:
−
** 957.775    
+
** 73.94432    
 
* Synonym(s):
 
* Synonym(s):
−
** 5E-3-oxo-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14803]]
+
* Reaction: [[GDPPYPHOSKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[GTPPYPHOSKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[PPGPPSYN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6427]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PPGPPMET-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=11763}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658857 90658857]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=8738}}
−
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J}}
+
{{#set: centisome position=73.94432   }}
−
{{#set: common name=5-trans-3-oxo-dodecenoyl-CoA}}
+
{{#set: reaction associated=GDPPYPHOSKIN-RXN|GTPPYPHOSKIN-RXN|PPGPPSYN-RXN|RXN0-6427}}
−
{{#set: molecular weight=957.775   }}
+
{{#set: pathway associated=PPGPPMET-PWY}}
−
{{#set: common name=5E-3-oxo-dodecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14803}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_6799

  • right end position:
    • 11763
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 8738
  • centisome position:
    • 73.94432
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6799&oldid=45810"