Difference between revisions of "ADEC"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADEC ADEC] == * direction: ** LEFT-TO-RIGHT * common name: ** adenylate cyclase * Synonym(s): == R...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADEC ADEC] ==
−
* smiles:
+
* direction:
−
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 2-(α-hydroxyethyl)thiamine diphosphate
+
** adenylate cyclase
−
* molecular weight:
+
−
** 466.341   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(α-hydroxyethyl)-TPP
 
−
** 2-(α-hydroxyethyl)-ThPP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12508]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[CAMP]][c]
−
* [[RXN-12583]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 ATP[c] '''=>''' 1.0 diphosphate[c] '''+''' 1.0 cyclic-AMP[c]
−
* [[RXN-14037]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8950]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_34]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_16143]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_10495]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
+
{{#set: common name=adenylate cyclase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_8950|Tiso_gene_34|Tiso_gene_16143|Tiso_gene_10495}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
+
{{#set: in pathway=}}
−
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=466.341    }}
+
−
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}}
+
−
{{#set: consumed by=RXN-12508}}
+
−
{{#set: produced by=RXN-12583}}
+
−
{{#set: consumed or produced by=RXN-14037}}
+

Latest revision as of 20:06, 21 March 2018

Reaction ADEC

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • adenylate cyclase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] => 1.0 diphosphate[c] + 1.0 cyclic-AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ADEC&oldid=45906"