Difference between revisions of "Alkyl-Hydro-Peroxides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == * smiles: ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkyl-Hydro-Peroxides Alkyl-Hydro-Peroxides] == * common name: ** an organic hydroperoxide * Sy...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkyl-Hydro-Peroxides Alkyl-Hydro-Peroxides] ==
−
* smiles:
+
−
** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
−
* inchi key:
+
−
** InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J
+
 
* common name:
 
* common name:
−
** vinylacetyl-CoA
+
** an organic hydroperoxide
−
* molecular weight:
+
−
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-butenoyl-CoA
+
** ROOH
−
** but-3-enoyl-CoA
+
** an alkylhydroperoxide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[R4-RXN]]
 +
* [[RXN0-5468]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[VINYLACETYL-COA-DELTA-ISOMERASE-RXN]]
+
* [[1.11.1.15-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an organic hydroperoxide}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266616 45266616]
+
{{#set: common name=ROOH|an alkylhydroperoxide}}
−
* CHEBI:
+
{{#set: consumed by=R4-RXN|RXN0-5468}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57396 57396]
+
{{#set: reversible reaction associated=1.11.1.15-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02331 C02331]
+
−
{{#set: smiles=C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
−
{{#set: inchi key=InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J}}
+
−
{{#set: common name=vinylacetyl-CoA}}
+
−
{{#set: molecular weight=831.577    }}
+
−
{{#set: common name=3-butenoyl-CoA|but-3-enoyl-CoA}}
+
−
{{#set: consumed or produced by=VINYLACETYL-COA-DELTA-ISOMERASE-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Metabolite Alkyl-Hydro-Peroxides

  • common name:
    • an organic hydroperoxide
  • Synonym(s):
    • ROOH
    • an alkylhydroperoxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Alkyl-Hydro-Peroxides&oldid=45915"