Difference between revisions of "METHFtx"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7422 CPD-7422] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtx METHFtx] == * direction: ** REVERSIBLE * common name: ** 5,10-Methenyltetrahydrofolate upta...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7422 CPD-7422] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtx METHFtx] ==
* smiles:
+
* direction:
** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
+
** REVERSIBLE
* inchi key:
+
** InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N
+
 
* common name:
 
* common name:
** α-zeacarotene
+
** 5,10-Methenyltetrahydrofolate uptake carrier, glyoxysome
* molecular weight:
+
** 538.898   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[5-10-METHENYL-THF]][c] '''<=>''' 1.0 [[5-10-METHENYL-THF]][x] '''+''' 1.0 [[PROTON]][x]
* [[RXN-8040]]
+
* With common name(s):
 +
** 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] '''<=>''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[x] '''+''' 1.0 H+[x]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19115]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR01070285
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: common name=5,10-Methenyltetrahydrofolate uptake carrier, glyoxysome}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6441660 6441660]
+
{{#set: gene associated=Tiso_gene_19115}}
* HMDB : HMDB36909
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C14146 C14146]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.4945802.html 4945802]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35063 35063]
+
{{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N}}
+
{{#set: common name=&alpha;-zeacarotene}}
+
{{#set: molecular weight=538.898    }}
+
{{#set: consumed or produced by=RXN-8040}}
+

Latest revision as of 20:06, 21 March 2018

Reaction METHFtx

  • direction:
    • REVERSIBLE
  • common name:
    • 5,10-Methenyltetrahydrofolate uptake carrier, glyoxysome
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] <=> 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[x] + 1.0 H+[x]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links