Difference between revisions of "Tiso gene 18070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == * smiles: ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18070 == * right end position: ** 2207 * transcription direction: ** POSITIVE * left end position: ** 361 * centisome position: ** 11.04651...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] ==
+
== Gene Tiso_gene_18070 ==
−
* smiles:
+
* right end position:
−
** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
+
** 2207
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** canavaninosuccinate
+
** 361
−
* molecular weight:
+
* centisome position:
−
** 291.24    
+
** 11.046512    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-22]]
+
* Reaction: [[2.7.7.14-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7782]]
 +
* [[PWY4FS-6]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2207}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820246 91820246]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB12197
+
{{#set: left end position=361}}
−
{{#set: smiles=C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O}}
+
{{#set: centisome position=11.046512   }}
−
{{#set: inchi key=InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M}}
+
{{#set: reaction associated=2.7.7.14-RXN}}
−
{{#set: common name=canavaninosuccinate}}
+
{{#set: pathway associated=PWY-7782|PWY4FS-6}}
−
{{#set: molecular weight=291.24   }}
+
−
{{#set: consumed by=RXN-22}}
+
−
{{#set: produced by=RXN-10}}
+

Latest revision as of 20:06, 21 March 2018

Gene Tiso_gene_18070

  • right end position:
    • 2207
  • transcription direction:
    • POSITIVE
  • left end position:
    • 361
  • centisome position:
    • 11.046512
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18070&oldid=45939"