Difference between revisions of "RETINOLSAT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RETINOLSAT RETINOLSAT] == * direction: ** LEFT-TO-RIGHT * common name: ** retinol saturase * Synony...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RETINOLSAT RETINOLSAT] ==
−
* smiles:
+
* direction:
−
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
+
 
* common name:
 
* common name:
−
** L-threonylcarbamoyladenylate
+
** retinol saturase
−
* molecular weight:
+
−
** 490.322   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14570]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PROTON]][s] '''+''' 1.0 [[NADPH]][s] '''+''' 1.0 [[Retinols]][s] '''=>''' 1.0 [[CPD-7247]][s] '''+''' 1.0 [[NADP]][s]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H+[s] '''+''' 1.0 NADPH[s] '''+''' 1.0 a retinol[s] '''=>''' 1.0 all-trans-13,14-dihydroretinol[s] '''+''' 1.0 NADP+[s]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16794]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
+
{{#set: common name=retinol saturase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_16794}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=L-threonylcarbamoyladenylate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=490.322    }}
+
−
{{#set: consumed by=RXN-14570}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RETINOLSAT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • retinol saturase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[s] + 1.0 NADPH[s] + 1.0 a retinol[s] => 1.0 all-trans-13,14-dihydroretinol[s] + 1.0 NADP+[s]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RETINOLSAT&oldid=45945"