Difference between revisions of "Tiso gene 13092"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13092 == * right end position: ** 2421 * transcription direction: ** POSITIVE * left end position: ** 26 * centisome position: ** 0.3977359...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] ==
+
== Gene Tiso_gene_13092 ==
−
* smiles:
+
* right end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 2421
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** benzoyl-CoA
+
** 26
−
* molecular weight:
+
* centisome position:
−
** 867.61    
+
** 0.39773598    
 
* Synonym(s):
 
* Synonym(s):
−
** S-benzoate coenzyme A
 
−
** benzoyl-S-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GDPMANDEHYDRA-RXN]]
−
* [[RXN-2006]]
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[GDPRHAMSYN-PWY]]
 +
* [[PWY-66]]
 +
* [[PWY-5740]]
 +
* [[PWY-7573]]
 +
* [[PWY-5738]]
 +
* [[PWY-5739]]
 
== External links  ==
 
== External links  ==
−
* CAS : 102185-37-5
+
{{#set: right end position=2421}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596]
+
{{#set: left end position=26}}
−
* CHEBI:
+
{{#set: centisome position=0.39773598   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369]
+
{{#set: reaction associated=GDPMANDEHYDRA-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=GDPRHAMSYN-PWY|PWY-66|PWY-5740|PWY-7573|PWY-5738|PWY-5739}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512]
+
−
* HMDB : HMDB02252
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}}
+
−
{{#set: common name=benzoyl-CoA}}
+
−
{{#set: molecular weight=867.61   }}
+
−
{{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}}
+
−
{{#set: produced by=RXN-2006}}
+

Latest revision as of 21:06, 21 March 2018

Gene Tiso_gene_13092

  • right end position:
    • 2421
  • transcription direction:
    • POSITIVE
  • left end position:
    • 26
  • centisome position:
    • 0.39773598
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13092&oldid=45962"