Difference between revisions of "CPD1F-131"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17619 RXN-17619] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C |
| − | * | + | * common name: |
| − | ** | + | ** antheraxanthin |
| + | * inchi key: | ||
| + | ** InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N | ||
| + | * molecular weight: | ||
| + | ** 584.881 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-7985]] |
| − | + | * [[RXN-7979]] | |
| − | * | + | * [[ANXANor]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7978]] | |
| − | == | + | * [[RXN-7984]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244322 25244322] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27867 27867] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08579 C08579] |
| + | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C}} | ||
| + | {{#set: common name=antheraxanthin}} | ||
| + | {{#set: inchi key=InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N}} | ||
| + | {{#set: molecular weight=584.881 }} | ||
| + | {{#set: consumed by=RXN-7985|RXN-7979|ANXANor}} | ||
| + | {{#set: produced by=RXN-7978|RXN-7984}} | ||
Latest revision as of 19:10, 21 March 2018
Contents
Metabolite CPD1F-131
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C
- common name:
- antheraxanthin
- inchi key:
- InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N
- molecular weight:
- 584.881
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
