Difference between revisions of "CPD-592"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16773 == * left end position: ** 1941 * transcription direction: ** POSITIVE * right end position: ** 3782 * centisome position: ** 47.0089...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == * smiles: ** C([O-])(=O)CCCNC(=[N+])N * common name: ** 4-guanidinobutanoat...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)CCCNC(=[N+])N |
− | * | + | * common name: |
− | ** | + | ** 4-guanidinobutanoate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 145.161 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-guanido-butyrate | ||
+ | ** γ-guanidinobutyrate | ||
+ | ** 4-guanidinobutyrate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[GUANIDINOBUTYRASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01035 C01035] |
− | {{#set: | + | * HMDB : HMDB03464 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57486 57486] |
+ | * METABOLIGHTS : MTBLC57486 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200642 25200642] | ||
+ | {{#set: smiles=C([O-])(=O)CCCNC(=[N+])N}} | ||
+ | {{#set: common name=4-guanidinobutanoate}} | ||
+ | {{#set: inchi key=InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=145.161 }} | ||
+ | {{#set: common name=4-guanido-butyrate|γ-guanidinobutyrate|4-guanidinobutyrate}} | ||
+ | {{#set: consumed by=GUANIDINOBUTYRASE-RXN}} | ||
+ | {{#set: produced by=GUANIDINOBUTANAMIDE-NH3-RXN}} |
Latest revision as of 21:06, 21 March 2018
Contents
Metabolite CPD-592
- smiles:
- C([O-])(=O)CCCNC(=[N+])N
- common name:
- 4-guanidinobutanoate
- inchi key:
- InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N
- molecular weight:
- 145.161
- Synonym(s):
- 4-guanido-butyrate
- γ-guanidinobutyrate
- 4-guanidinobutyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CCCNC(=[N+])N" cannot be used as a page name in this wiki.