Difference between revisions of "RXN-10994"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] == * direction: ** REVERSIBLE * common name: ** 4_-phosphopantetheinyl_transfe...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4_-phosphopantetheinyl_transferase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CO-A]][c] '''+''' 1 [[VibB]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[holo-VibB]][c] '''+''' 1 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 coenzyme A[c] '''+''' 1 an apo-[VibB aryl-carrier protein][c] '''<=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a holo-[VibB aryl-carrier protein][c] '''+''' 1 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_14278]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=4_-phosphopantetheinyl_transferase}} | |
| − | + | {{#set: ec number=EC-2.7.8.7}} | |
| − | + | {{#set: gene associated=Tiso_gene_14278}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:06, 21 March 2018
Contents
Reaction RXN-10994
- direction:
- REVERSIBLE
- common name:
- 4_-phosphopantetheinyl_transferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 coenzyme A[c] + 1 an apo-[VibB aryl-carrier protein][c] <=> 1 adenosine 3',5'-bisphosphate[c] + 1 a holo-[VibB aryl-carrier protein][c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14278
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
