Difference between revisions of "CPD-4127"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12171 RXN-12171] == * direction: ** REVERSIBLE * common name: ** thymidine_phosphorylase * ec n...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12171 RXN-12171] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** thymidine_phosphorylase
+
** isofucosterol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
+
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Pi]][c] '''+''' 1 [[Maltodextrins]][c] '''<=>''' 1 [[GLC-1-P]][c] '''+''' 1 [[Maltodextrins]][c]
+
* [[RXN-4210]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 phosphate[c] '''+''' 1 a maltodextrin[c] '''<=>''' 1 &alpha;-D-glucopyranose 1-phosphate[c] '''+''' 1 a maltodextrin[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1011]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6731]], starch degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6731 PWY-6731]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6737]], starch degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6737 PWY-6737]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=thymidine_phosphorylase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326]
−
{{#set: ec number=EC-2.4.1.1}}
+
* HMDB : HMDB02374
−
{{#set: gene associated=Tiso_gene_1011}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-6731|PWY-6737}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=isofucosterol}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: produced by=RXN-4210}}

Latest revision as of 20:06, 21 March 2018

Metabolite CPD-4127

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • isofucosterol
  • inchi key:
    • InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4127&oldid=46028"