Difference between revisions of "Tiso gene 16258"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
 
(Created page with "Category:Gene == Gene Tiso_gene_16258 == * right end position: ** 4351 * transcription direction: ** POSITIVE * left end position: ** 1743 * centisome position: ** 38.9062...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
+
== Gene Tiso_gene_16258 ==
−
* smiles:
+
* right end position:
−
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 4351
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** isofucosterol
+
** 1743
−
* molecular weight:
+
* centisome position:
−
** 412.698    
+
** 38.90625    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLUTSEMIALDEHYDROG-RXN]]
−
* [[RXN-4210]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6922]]
 +
* [[PROSYN-PWY]]
 +
* [[PWY-3341]]
 +
* [[ARGININE-SYN4-PWY]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4351}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=1743}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
+
{{#set: centisome position=38.90625    }}
−
* HMDB : HMDB02374
+
{{#set: reaction associated=GLUTSEMIALDEHYDROG-RXN}}
−
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: pathway associated=PWY-6922|PROSYN-PWY|PWY-3341|ARGININE-SYN4-PWY|CITRULBIO-PWY}}
−
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
+
−
{{#set: common name=isofucosterol}}
+
−
{{#set: molecular weight=412.698    }}
+
−
{{#set: produced by=RXN-4210}}
+

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_16258

  • right end position:
    • 4351
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1743
  • centisome position:
    • 38.90625
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16258&oldid=46034"