Difference between revisions of "PWY-7384"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] == * smiles: ** C1(N=CC=NC=1C(=O)N) * inchi key: ** InChIKey=IPEHBUM...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6231 TAX-62...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384] ==
−
* smiles:
+
* taxonomic range:
−
** C1(N=CC=NC=1C(=O)N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6231 TAX-6231]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6157 TAX-6157]
−
** InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6340 TAX-6340]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6447 TAX-6447]
 
* common name:
 
* common name:
−
** pyrazinamide
+
** anaerobic energy metabolism (invertebrates, mitochondrial)
−
* molecular weight:
+
−
** 123.114   
+
 
* Synonym(s):
 
* Synonym(s):
−
** pyrazinecarboxamide
 
−
** pyrazinoic acid amide
 
−
** pyrazine carboxylamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[PYRAZIN-RXN]]
+
'''7''' reactions found over '''12''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.39-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_12896]]
 +
*** [[Tiso_gene_6675]]
 +
*** [[Tiso_gene_12200]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3691]]
 +
*** [[Tiso_gene_6720]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[METHYLMALONYL-COA-MUT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9771]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_5029]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[PWY-5537]]
 +
** 0 associated gene:
 +
* [[PYRUVDEH-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_2515]]
 +
*** [[Tiso_gene_6983]]
 +
*** [[Tiso_gene_17539]]
 +
*** [[Tiso_gene_2693]]
 +
*** [[Tiso_gene_9330]]
 +
*** [[Tiso_gene_7519]]
 +
*** [[Tiso_gene_19780]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15846]]
 +
*** [[Tiso_gene_11866]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14963 RXN-14963]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8807 RXN-8807]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-268 RXN0-268]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: taxonomic range=TAX-6231}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=14911 14911]
+
{{#set: taxonomic range=TAX-6157}}
−
* DRUGBANK : DB00339
+
{{#set: taxonomic range=TAX-6340}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-6447}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1046 1046]
+
{{#set: common name=anaerobic energy metabolism (invertebrates, mitochondrial)}}
−
* HMDB : HMDB14483
+
{{#set: reaction found=7}}
−
* LIGAND-CPD:
+
{{#set: total reaction=12}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01956 C01956]
+
{{#set: completion rate=58.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.1017.html 1017]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45285 45285]
+
−
{{#set: smiles=C1(N=CC=NC=1C(=O)N)}}
+
−
{{#set: inchi key=InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N}}
+
−
{{#set: common name=pyrazinamide}}
+
−
{{#set: molecular weight=123.114    }}
+
−
{{#set: common name=pyrazinecarboxamide|pyrazinoic acid amide|pyrazine carboxylamide}}
+
−
{{#set: consumed by=PYRAZIN-RXN}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-7384

Reaction(s) found

7 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7384&oldid=39941"