Difference between revisions of "Tiso gene 4735"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
(Created page with "Category:Gene == Gene Tiso_gene_4735 == * right end position: ** 8508 * transcription direction: ** POSITIVE * left end position: ** 6724 * centisome position: ** 46.73338...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4735 == |
− | * | + | * right end position: |
− | ** | + | ** 8508 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 6724 |
− | * | + | * centisome position: |
− | ** | + | ** 46.733387 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN0- | + | * Reaction: [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN0-6491]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN0-6554]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5686]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8508}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=6724}} | |
− | + | {{#set: centisome position=46.733387 }} | |
− | + | {{#set: reaction associated=DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN0-6491|RXN0-6554}} | |
− | + | {{#set: pathway associated=PWY-5686}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:07, 21 March 2018
Gene Tiso_gene_4735
- right end position:
- 8508
- transcription direction:
- POSITIVE
- left end position:
- 6724
- centisome position:
- 46.733387
- Synonym(s):
Reactions associated
- Reaction: DIHYDROOROTATE-DEHYDROGENASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-6491
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-6554
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation