Difference between revisions of "Tiso gene 17185"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17185 == * right end position: ** 3821 * transcription direction: ** NEGATIVE * left end position: ** 183 * centisome position: ** 4.737251...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] ==
+
== Gene Tiso_gene_17185 ==
* smiles:
+
* right end position:
** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
** 3821
* inchi key:
+
* transcription direction:
** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
+
** NEGATIVE
* common name:
+
* left end position:
** XLXG xyloglucan oligosaccharide
+
** 183
* molecular weight:
+
* centisome position:
** 1225.073    
+
** 4.737251    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12399]]
+
* Reaction: [[ASPARTATE--TRNA-LIGASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=3821}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: left end position=183}}
{{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}}
+
{{#set: centisome position=4.737251   }}
{{#set: common name=XLXG xyloglucan oligosaccharide}}
+
{{#set: reaction associated=ASPARTATE--TRNA-LIGASE-RXN}}
{{#set: molecular weight=1225.073   }}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
{{#set: consumed by=RXN-12399}}
+

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_17185

  • right end position:
    • 3821
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 183
  • centisome position:
    • 4.737251
  • Synonym(s):

Reactions associated

Pathways associated

External links