Difference between revisions of "CPD-19491"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4735 == * left end position: ** 6724 * transcription direction: ** POSITIVE * right end position: ** 8508 * centisome position: ** 46.73338...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * common name: ** 3-isop...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_4735 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] ==
* left end position:
+
* smiles:
** 6724
+
** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** 3-isopropyl-6-(methylthio)-2-oxohexanoate
* right end position:
+
* inchi key:
** 8508
+
** InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L
* centisome position:
+
* molecular weight:
** 46.733387    
+
** 218.224    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
* [[RXN-18209]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
* [[RXN0-6491]]
+
* [[RXN-18208]]
** in-silico_annotation
+
***ec-number
+
* [[RXN0-6554]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-5686]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=6724}}
+
{{#set: smiles=C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: common name=3-isopropyl-6-(methylthio)-2-oxohexanoate}}
{{#set: right end position=8508}}
+
{{#set: inchi key=InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L}}
{{#set: centisome position=46.733387   }}
+
{{#set: molecular weight=218.224   }}
{{#set: reaction associated=DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN0-6491|RXN0-6554}}
+
{{#set: consumed by=RXN-18209}}
{{#set: pathway associated=PWY-5686}}
+
{{#set: reversible reaction associated=RXN-18208}}

Latest revision as of 21:07, 21 March 2018

Metabolite CPD-19491

  • smiles:
    • C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]
  • common name:
    • 3-isopropyl-6-(methylthio)-2-oxohexanoate
  • inchi key:
    • InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L
  • molecular weight:
    • 218.224
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.