Difference between revisions of "Tiso gene 17112"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17112 == * right end position: ** 3290 * transcription direction: ** POSITIVE * left end position: ** 857 * centisome position: ** 21.90135...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] ==
+
== Gene Tiso_gene_17112 ==
−
* smiles:
+
* right end position:
−
** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]
+
** 3290
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-isopropyl-6-(methylthio)-2-oxohexanoate
+
** 857
−
* molecular weight:
+
* centisome position:
−
** 218.224    
+
** 21.901354    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-18209]]
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[RXN-18208]]
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]}}
+
{{#set: right end position=3290}}
−
{{#set: inchi key=InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=3-isopropyl-6-(methylthio)-2-oxohexanoate}}
+
{{#set: left end position=857}}
−
{{#set: molecular weight=218.224   }}
+
{{#set: centisome position=21.901354   }}
−
{{#set: consumed by=RXN-18209}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: consumed or produced by=RXN-18208}}
+
{{#set: pathway associated=PWY-7511}}

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_17112

  • right end position:
    • 3290
  • transcription direction:
    • POSITIVE
  • left end position:
    • 857
  • centisome position:
    • 21.901354
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17112&oldid=46164"