Difference between revisions of "Protein-L-serines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-serines Protein-L-serines] == * common name: ** a [protein]-L-serine * Synonym(s): =...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-serines Protein-L-serines] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [protein]-L-serine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[2. | + | * [[2.7.12.1-RXN]] |
| − | * [[ | + | * [[5.1.1.16-RXN]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=a [protein]-L-serine}} | |
| − | + | {{#set: reversible reaction associated=2.7.12.1-RXN|5.1.1.16-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:10, 21 March 2018
Contents
Metabolite Protein-L-serines
- common name:
- a [protein]-L-serine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-serine" cannot be used as a page name in this wiki.
