Difference between revisions of "CPD-19492"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=QDZNKMGEHAHO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * common name: ** 3-ethyl-2-o...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCC(C([O-])=O)C(C(=O)[O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-ethyl-2-oxosuccinate |
+ | * inchi key: | ||
+ | ** InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 158.11 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-18211]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-18210]] | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])=O}} | |
− | + | {{#set: common name=3-ethyl-2-oxosuccinate}} | |
− | + | {{#set: inchi key=InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=158.11 }} |
− | {{#set: | + | {{#set: consumed by=RXN-18211}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-18210}} |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPD-19492
- smiles:
- CCC(C([O-])=O)C(C(=O)[O-])=O
- common name:
- 3-ethyl-2-oxosuccinate
- inchi key:
- InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
- molecular weight:
- 158.11
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C([O-])=O)C(C(=O)[O-])=O" cannot be used as a page name in this wiki.