Difference between revisions of "CPD-19492"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=QDZNKMGEHAHO...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * common name: ** 3-ethyl-2-o...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] ==
 
* smiles:
 
* smiles:
** CSCCCCCCC(=O)C([O-])=O
+
** CCC(C([O-])=O)C(C(=O)[O-])=O
* inchi key:
+
** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 8-(methylthio)-2-oxooctanoate
+
** 3-ethyl-2-oxosuccinate
 +
* inchi key:
 +
** InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
 
* molecular weight:
 
* molecular weight:
** 203.276    
+
** 158.11    
 
* Synonym(s):
 
* Synonym(s):
** 8-(methylthio)-2-oxooctanoic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-18211]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18205]]
 
* [[RXNQT-4171]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-18210]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])=O}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313]
+
{{#set: common name=3-ethyl-2-oxosuccinate}}
* KNAPSACK : C00007643
+
{{#set: inchi key=InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L}}
{{#set: smiles=CSCCCCCCC(=O)C([O-])=O}}
+
{{#set: molecular weight=158.11   }}
{{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}}
+
{{#set: consumed by=RXN-18211}}
{{#set: common name=8-(methylthio)-2-oxooctanoate}}
+
{{#set: reversible reaction associated=RXN-18210}}
{{#set: molecular weight=203.276   }}
+
{{#set: common name=8-(methylthio)-2-oxooctanoic acid}}
+
{{#set: produced by=RXN-18205|RXNQT-4171}}
+

Latest revision as of 21:08, 21 March 2018

Metabolite CPD-19492

  • smiles:
    • CCC(C([O-])=O)C(C(=O)[O-])=O
  • common name:
    • 3-ethyl-2-oxosuccinate
  • inchi key:
    • InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
  • molecular weight:
    • 158.11
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C([O-])=O)C(C(=O)[O-])=O" cannot be used as a page name in this wiki.