Difference between revisions of "BCCP-dimers"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * inchi key: ** InChIKey=OUGL...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-dimers BCCP-dimers] == * common name: ** a biotinylated [BCCP dimer] * Synonym(s): ** a bi...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-dimers BCCP-dimers] ==
* smiles:
+
** CCC(C([O-])=O)C(C(=O)[O-])=O
+
* inchi key:
+
** InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** 3-ethyl-2-oxosuccinate
+
** a biotinylated [BCCP dimer]
* molecular weight:
+
** 158.11   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a biotinylated [biotin-carboxy-carrier-protein dimer]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18211]]
+
* [[BIOTIN-CARBOXYL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7101]]
 +
* [[RXN0-5055]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-18210]]
 
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])=O}}
+
{{#set: common name=a biotinylated [BCCP dimer]}}
{{#set: inchi key=InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L}}
+
{{#set: common name=a biotinylated [biotin-carboxy-carrier-protein dimer]}}
{{#set: common name=3-ethyl-2-oxosuccinate}}
+
{{#set: consumed by=BIOTIN-CARBOXYL-RXN}}
{{#set: molecular weight=158.11    }}
+
{{#set: produced by=RXN-7101|RXN0-5055}}
{{#set: consumed by=RXN-18211}}
+
{{#set: consumed or produced by=RXN-18210}}
+

Latest revision as of 20:08, 21 March 2018

Metabolite BCCP-dimers

  • common name:
    • a biotinylated [BCCP dimer]
  • Synonym(s):
    • a biotinylated [biotin-carboxy-carrier-protein dimer]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a biotinylated [BCCP dimer" cannot be used as a page name in this wiki.
"a biotinylated [biotin-carboxy-carrier-protein dimer" cannot be used as a page name in this wiki.