Difference between revisions of "Tiso gene 5199"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17388 CPD-17388] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5199 == * right end position: ** 13641 * transcription direction: ** POSITIVE * left end position: ** 10190 * centisome position: ** 73.867...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17388 CPD-17388] ==
+
== Gene Tiso_gene_5199 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 13641
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DNHDPAXPQGYGIJ-KWFBMMABSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
+
** 10190
−
* molecular weight:
+
* centisome position:
−
** 1116.018    
+
** 73.86735    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16137]]
+
* Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-16136]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13641}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581251 71581251]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=10190}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74304 74304]
+
{{#set: centisome position=73.86735   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
{{#set: inchi key=InChIKey=DNHDPAXPQGYGIJ-KWFBMMABSA-J}}
+
−
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
+
−
{{#set: molecular weight=1116.018   }}
+
−
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16137}}
+
−
{{#set: produced by=RXN-16136}}
+

Latest revision as of 20:08, 21 March 2018

Gene Tiso_gene_5199

  • right end position:
    • 13641
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10190
  • centisome position:
    • 73.86735
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5199&oldid=46294"