Difference between revisions of "COUMARYL-ALCOHOL"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-RACEMASE-RXN ASPARTATE-RACEMASE-RXN] == * direction: ** REVERSIBLE * common name: ** ORF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * common name: ** 4-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == |
− | * | + | * smiles: |
− | ** | + | ** C(=CC1(=CC=C(O)C=C1))CO |
* common name: | * common name: | ||
− | ** | + | ** 4-coumaryl alcohol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N |
+ | * molecular weight: | ||
+ | ** 150.177 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** p-coumaryl alcohol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-1102]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166] |
− | * | + | * HMDB : HMDB03654 |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386] |
− | ** [http://www. | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646] |
− | {{#set: common name= | + | {{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}} |
− | + | {{#set: common name=4-coumaryl alcohol}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}} |
− | + | {{#set: molecular weight=150.177 }} | |
− | {{#set: | + | {{#set: common name=p-coumaryl alcohol}} |
− | {{#set: | + | {{#set: produced by=RXN-1102}} |
− | {{#set: | + |
Latest revision as of 19:10, 21 March 2018
Contents
Metabolite COUMARYL-ALCOHOL
- smiles:
- C(=CC1(=CC=C(O)C=C1))CO
- common name:
- 4-coumaryl alcohol
- inchi key:
- InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
- molecular weight:
- 150.177
- Synonym(s):
- p-coumaryl alcohol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links