Difference between revisions of "CPD-13375"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GBDP GBDP] == * direction: ** REVERSIBLE * common name: ** guanosine-3',5'-bis(diphosphate) 3'-diph...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GBDP GBDP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
 
* common name:
 
* common name:
−
** guanosine-3',5'-bis(diphosphate) 3'-diphosphatase
+
** XXXG xyloglucan oligosaccharide
 +
* inchi key:
 +
** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
 +
* molecular weight:
 +
** 1062.931   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[GUANOSINE-5DP-3DP]][c] '''+''' 1.0 [[WATER]][c] '''<=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[GDP]][c]
+
* [[RXN-12400]]
−
* With common name(s):
+
* [[RXN-12399]]
−
** 1.0 ppGpp[c] '''+''' 1.0 H2O[c] '''<=>''' 1.0 diphosphate[c] '''+''' 1.0 GDP[c]
+
* [[RXN-12398]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_16305]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=guanosine-3',5'-bis(diphosphate) 3'-diphosphatase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180]
−
{{#set: gene associated=Tiso_gene_16305}}
+
{{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}}
−
{{#set: in pathway=}}
+
{{#set: common name=XXXG xyloglucan oligosaccharide}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=1062.931    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: produced by=RXN-12400|RXN-12399|RXN-12398}}

Latest revision as of 20:09, 21 March 2018

Metabolite CPD-13375

  • smiles:
    • C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
  • common name:
    • XXXG xyloglucan oligosaccharide
  • inchi key:
    • InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
  • molecular weight:
    • 1062.931
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13375&oldid=46321"