Difference between revisions of "RXN-7697"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7697 RXN-7697] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7697 RXN-7697] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J
+
** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199]
−
* common name:
+
−
** 3-hydroxypropanoyl-CoA
+
−
* molecular weight:
+
−
** 835.566   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxypropionyl-coenzyme A
 
−
** 3-hydroxypropionyl-CoA
 
−
** 3-hydroxypropanoyl coenzymeA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-6384]]
+
* With identifiers:
−
* [[HICH]]
+
** 1 [[Very-long-Chain-234-Saturated-acyl-CoAs]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[Very-Long-Chain-oxoacyl-CoAs]][c] '''+''' 1 [[CO-A]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a very-long-chain 2,3,4-saturated fatty acyl CoA[c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 CO2[c] '''+''' 1 a very-long-chain oxoacyl-CoA[c] '''+''' 1 coenzyme A[c]
−
* [[RXN-6383]]
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5080]], very long chain fatty acid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5080 PWY-5080]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05668 C05668]
+
{{#set: ec number=EC-2.3.1.199}}
−
* CHEBI:
+
{{#set: in pathway=PWY-5080}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58528 58528]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC58528
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* PUBCHEM:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229175 44229175]
+
−
* HMDB : HMDB06807
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J}}
+
−
{{#set: common name=3-hydroxypropanoyl-CoA}}
+
−
{{#set: molecular weight=835.566    }}
+
−
{{#set: common name=3-hydroxypropionyl-coenzyme A|3-hydroxypropionyl-CoA|3-hydroxypropanoyl coenzymeA}}
+
−
{{#set: consumed by=RXN-6384|HICH}}
+
−
{{#set: consumed or produced by=RXN-6383}}
+

Latest revision as of 20:09, 21 March 2018

Reaction RXN-7697

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-5080, very long chain fatty acid biosynthesis I: PWY-5080
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7697&oldid=46356"